C7H9ClN2O2S — CID 107638348
1-chloro-4-methyl-2-(sulfamoylamino)benzene (PubChem CID 107638348) has the molecular formula C7H9ClN2O2S and a molecular weight of 220.68 g/mol. Its IUPAC name is 1-chloro-4-methyl-2-(sulfamoylamino)benzene.
| Compound Name | 1-chloro-4-methyl-2-(sulfamoylamino)benzene |
|---|---|
| PubChem CID | 107638348 |
| Molecular Formula | C7H9ClN2O2S |
| Molecular Weight | 220.68 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 1-chloro-4-methyl-2-(sulfamoylamino)benzene |
| SMILES | Cc1ccc(Cl)c(NS(N)(=O)=O)c1 |
| InChI | InChI=1S/C7H9ClN2O2S/c1-5-2-3-6(8)7(4-5)10-13(9,11)12/h2-4,10H,1H3,(H2,9,11,12) |
| InChIKey | SAIACZZSRHXMLA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.68 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |