C7H8ClN3O2S2 — CID 114959203
4-chloro-3-(sulfamoylamino)benzenecarbothioamide (PubChem CID 114959203) has the molecular formula C7H8ClN3O2S2 and a molecular weight of 265.75 g/mol. Its IUPAC name is 4-chloro-3-(sulfamoylamino)benzenecarbothioamide.
| Compound Name | 4-chloro-3-(sulfamoylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 114959203 |
| Molecular Formula | C7H8ClN3O2S2 |
| Molecular Weight | 265.75 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | 4-chloro-3-(sulfamoylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Cl)c(NS(N)(=O)=O)c1 |
| InChI | InChI=1S/C7H8ClN3O2S2/c8-5-2-1-4(7(9)14)3-6(5)11-15(10,12)13/h1-3,11H,(H2,9,14)(H2,10,12,13) |
| InChIKey | ISIXBLKDTPRBGK-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.75 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|