C10H12ClN3O2S2 — CID 114808498
4-chloro-3-(cyclopropylsulfamoylamino)benzenecarbothioamide (PubChem CID 114808498) has the molecular formula C10H12ClN3O2S2 and a molecular weight of 305.81 g/mol. Its IUPAC name is 4-chloro-3-(cyclopropylsulfamoylamino)benzenecarbothioamide.
| Compound Name | 4-chloro-3-(cyclopropylsulfamoylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 114808498 |
| Molecular Formula | C10H12ClN3O2S2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 4-chloro-3-(cyclopropylsulfamoylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Cl)c(NS(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C10H12ClN3O2S2/c11-8-4-1-6(10(12)17)5-9(8)14-18(15,16)13-7-2-3-7/h1,4-5,7,13-14H,2-3H2,(H2,12,17) |
| InChIKey | UUZJACLLABXHJE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|