C9H12ClN3O2S — CID 114804566
4-chloro-3-N-(cyclopropylsulfamoyl)benzene-1,3-diamine (PubChem CID 114804566) has the molecular formula C9H12ClN3O2S and a molecular weight of 261.73 g/mol. Its IUPAC name is 4-chloro-3-N-(cyclopropylsulfamoyl)benzene-1,3-diamine.
| Compound Name | 4-chloro-3-N-(cyclopropylsulfamoyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 114804566 |
| Molecular Formula | C9H12ClN3O2S |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 4-chloro-3-N-(cyclopropylsulfamoyl)benzene-1,3-diamine |
| SMILES | Nc1ccc(Cl)c(NS(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C9H12ClN3O2S/c10-8-4-1-6(11)5-9(8)13-16(14,15)12-7-2-3-7/h1,4-5,7,12-13H,2-3,11H2 |
| InChIKey | HWCZZPMZPXYWEZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|