C12H12ClN3O2S — CID 54903074
2-(5-amino-2-chloroanilino)benzenesulfonamide (PubChem CID 54903074) has the molecular formula C12H12ClN3O2S and a molecular weight of 297.77 g/mol. Its IUPAC name is 2-(5-amino-2-chloroanilino)benzenesulfonamide.
| Compound Name | 2-(5-amino-2-chloroanilino)benzenesulfonamide |
|---|---|
| PubChem CID | 54903074 |
| Molecular Formula | C12H12ClN3O2S |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 2-(5-amino-2-chloroanilino)benzenesulfonamide |
| SMILES | Nc1ccc(Cl)c(Nc2ccccc2S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H12ClN3O2S/c13-9-6-5-8(14)7-11(9)16-10-3-1-2-4-12(10)19(15,17)18/h1-7,16H,14H2,(H2,15,17,18) |
| InChIKey | QFPUQPZIRPGGAO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|