C10H13BrN4O3S — CID 107790866
3-bromo-4-(cyclopropylsulfamoylamino)-N'-hydroxybenzenecarboximidamide (PubChem CID 107790866) has the molecular formula C10H13BrN4O3S and a molecular weight of 349.21 g/mol. Its IUPAC name is 3-bromo-4-(cyclopropylsulfamoylamino)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-bromo-4-(cyclopropylsulfamoylamino)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 107790866 |
| Molecular Formula | C10H13BrN4O3S |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 3-bromo-4-(cyclopropylsulfamoylamino)-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(NS(=O)(=O)NC2CC2)c(Br)c1 |
| InChI | InChI=1S/C10H13BrN4O3S/c11-8-5-6(10(12)13-16)1-4-9(8)15-19(17,18)14-7-2-3-7/h1,4-5,7,14-16H,2-3H2,(H2,12,13) |
| InChIKey | LKDFIAJNHFULNX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|