C11H12BrN5O3S — CID 107790886
3-bromo-N'-hydroxy-4-[(1-methylimidazol-4-yl)sulfonylamino]benzenecarboximidamide (PubChem CID 107790886) has the molecular formula C11H12BrN5O3S and a molecular weight of 374.22 g/mol. Its IUPAC name is 3-bromo-N'-hydroxy-4-[(1-methylimidazol-4-yl)sulfonylamino]benzenecarboximidamide.
| Compound Name | 3-bromo-N'-hydroxy-4-[(1-methylimidazol-4-yl)sulfonylamino]benzenecarboximidamide |
|---|---|
| PubChem CID | 107790886 |
| Molecular Formula | C11H12BrN5O3S |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 3-bromo-N'-hydroxy-4-[(1-methylimidazol-4-yl)sulfonylamino]benzenecarboximidamide |
| SMILES | Cn1cnc(S(=O)(=O)Nc2ccc(/C(N)=N/O)cc2Br)c1 |
| InChI | InChI=1S/C11H12BrN5O3S/c1-17-5-10(14-6-17)21(19,20)16-9-3-2-7(4-8(9)12)11(13)15-18/h2-6,16,18H,1H3,(H2,13,15) |
| InChIKey | JAFZLOBICJUSNZ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|