C11H15FN4O3S — CID 114812348
4-[(cyclopropylsulfamoylamino)methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 114812348) has the molecular formula C11H15FN4O3S and a molecular weight of 302.33 g/mol. Its IUPAC name is 4-[(cyclopropylsulfamoylamino)methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[(cyclopropylsulfamoylamino)methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 114812348 |
| Molecular Formula | C11H15FN4O3S |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 4-[(cyclopropylsulfamoylamino)methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(CNS(=O)(=O)NC2CC2)c(F)c1 |
| InChI | InChI=1S/C11H15FN4O3S/c12-10-5-7(11(13)15-17)1-2-8(10)6-14-20(18,19)16-9-3-4-9/h1-2,5,9,14,16-17H,3-4,6H2,(H2,13,15) |
| InChIKey | BREVTVJDTCMOJV-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|