C10H13FN4O2S — CID 114813590
4-(cyclopropylsulfamoylamino)-3-fluorobenzenecarboximidamide (PubChem CID 114813590) has the molecular formula C10H13FN4O2S and a molecular weight of 272.30 g/mol. Its IUPAC name is 4-(cyclopropylsulfamoylamino)-3-fluorobenzenecarboximidamide.
| Compound Name | 4-(cyclopropylsulfamoylamino)-3-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 114813590 |
| Molecular Formula | C10H13FN4O2S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 4-(cyclopropylsulfamoylamino)-3-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NS(=O)(=O)NC2CC2)c(F)c1 |
| InChI | InChI=1S/C10H13FN4O2S/c11-8-5-6(10(12)13)1-4-9(8)15-18(16,17)14-7-2-3-7/h1,4-5,7,14-15H,2-3H2,(H3,12,13) |
| InChIKey | KNFYCTRZQKLQST-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|