C10H13ClFN3O2 — CID 82253267
3-(4-carbamimidoyl-2-fluoroanilino)propanoic acid;hydrochloride (PubChem CID 82253267) has the molecular formula C10H13ClFN3O2 and a molecular weight of 261.68 g/mol. Its IUPAC name is 3-(4-carbamimidoyl-2-fluoroanilino)propanoic acid;hydrochloride.
| Compound Name | 3-(4-carbamimidoyl-2-fluoroanilino)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 82253267 |
| Molecular Formula | C10H13ClFN3O2 |
| Molecular Weight | 261.68 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 3-(4-carbamimidoyl-2-fluoroanilino)propanoic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NCCC(=O)O)c(F)c1 |
| InChI | InChI=1S/C10H12FN3O2.ClH/c11-7-5-6(10(12)13)1-2-8(7)14-4-3-9(15)16;/h1-2,5,14H,3-4H2,(H3,12,13)(H,15,16);1H |
| InChIKey | CBFJVOORONMWNN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 99.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.68 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|