C15H19ClN4 — CID 22125505
4-amino-3-(2-phenylethylamino)benzenecarboximidamide;hydrochloride (PubChem CID 22125505) has the molecular formula C15H19ClN4 and a molecular weight of 290.80 g/mol. Its IUPAC name is 4-amino-3-(2-phenylethylamino)benzenecarboximidamide;hydrochloride.
| Compound Name | 4-amino-3-(2-phenylethylamino)benzenecarboximidamide;hydrochloride |
|---|---|
| PubChem CID | 22125505 |
| Molecular Formula | C15H19ClN4 |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 4-amino-3-(2-phenylethylamino)benzenecarboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(N)c(NCCc2ccccc2)c1 |
| InChI | InChI=1S/C15H18N4.ClH/c16-13-7-6-12(15(17)18)10-14(13)19-9-8-11-4-2-1-3-5-11;/h1-7,10,19H,8-9,16H2,(H3,17,18);1H |
| InChIKey | XXPMGOWFTJKAIY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|