C19H18N4 — CID 142296312
3,4-dianilinobenzenecarboximidamide (PubChem CID 142296312) has the molecular formula C19H18N4 and a molecular weight of 302.38 g/mol. Its IUPAC name is 3,4-dianilinobenzenecarboximidamide.
| Compound Name | 3,4-dianilinobenzenecarboximidamide |
|---|---|
| PubChem CID | 142296312 |
| Molecular Formula | C19H18N4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 3,4-dianilinobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Nc2ccccc2)c(Nc2ccccc2)c1 |
| InChI | InChI=1S/C19H18N4/c20-19(21)14-11-12-17(22-15-7-3-1-4-8-15)18(13-14)23-16-9-5-2-6-10-16/h1-13,22-23H,(H3,20,21) |
| InChIKey | WRCGUNCDSXEWAB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 73.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|