C20H19N3 — CID 142223741
4-[(4-phenylphenyl)methylamino]benzenecarboximidamide (PubChem CID 142223741) has the molecular formula C20H19N3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 4-[(4-phenylphenyl)methylamino]benzenecarboximidamide.
| Compound Name | 4-[(4-phenylphenyl)methylamino]benzenecarboximidamide |
|---|---|
| PubChem CID | 142223741 |
| Molecular Formula | C20H19N3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 4-[(4-phenylphenyl)methylamino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NCc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C20H19N3/c21-20(22)18-10-12-19(13-11-18)23-14-15-6-8-17(9-7-15)16-4-2-1-3-5-16/h1-13,23H,14H2,(H3,21,22) |
| InChIKey | XSLIXJUMAYJADS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|