C51H43N3 — CID 145237235
benzenecarboximidamide;N-[[4-(9,9-diphenyl-4b,5-dihydrofluoren-4-yl)phenyl]methyl]-4-phenylaniline (PubChem CID 145237235) has the molecular formula C51H43N3 and a molecular weight of 697.93 g/mol. Its IUPAC name is benzenecarboximidamide;N-[[4-(9,9-diphenyl-4b,5-dihydrofluoren-4-yl)phenyl]methyl]-4-phenylaniline.
| Compound Name | benzenecarboximidamide;N-[[4-(9,9-diphenyl-4b,5-dihydrofluoren-4-yl)phenyl]methyl]-4-phenylaniline |
|---|---|
| PubChem CID | 145237235 |
| Molecular Formula | C51H43N3 |
| Molecular Weight | 697.93 g/mol |
| Exact Mass | 697.35 |
| IUPAC Name | benzenecarboximidamide;N-[[4-(9,9-diphenyl-4b,5-dihydrofluoren-4-yl)phenyl]methyl]-4-phenylaniline |
| SMILES | C1=CCC2C(=C1)C(c1ccccc1)(c1ccccc1)c1cccc(-c3ccc(CNc4ccc(-c5ccccc5)cc4)cc3)c12.[H]/N=C(\N)c1ccccc1 |
| InChI | InChI=1S/C44H35N.C7H8N2/c1-4-13-33(14-5-1)34-27-29-38(30-28-34)45-31-32-23-25-35(26-24-32)39-20-12-22-42-43(39)40-19-10-11-21-41(40)44(42,36-15-6-2-7-16-36)37-17-8-3-9-18-37;8-7(9)6-4-2-1-3-5-6/h1-18,20-30,40,45H,19,31H2;1-5H,(H3,8,9) |
| InChIKey | ZSECJXPEMKYBFI-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.93 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|