C16H22Cl2N6 — CID 46837859
4-[2-(4-carbamimidoylanilino)ethylamino]benzenecarboximidamide;dihydrochloride (PubChem CID 46837859) has the molecular formula C16H22Cl2N6 and a molecular weight of 369.30 g/mol. Its IUPAC name is 4-[2-(4-carbamimidoylanilino)ethylamino]benzenecarboximidamide;dihydrochloride.
| Compound Name | 4-[2-(4-carbamimidoylanilino)ethylamino]benzenecarboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 46837859 |
| Molecular Formula | C16H22Cl2N6 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 4-[2-(4-carbamimidoylanilino)ethylamino]benzenecarboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(NCCNc2ccc(/C(N)=N/[H])cc2)cc1 |
| InChI | InChI=1S/C16H20N6.2ClH/c17-15(18)11-1-5-13(6-2-11)21-9-10-22-14-7-3-12(4-8-14)16(19)20;;/h1-8,21-22H,9-10H2,(H3,17,18)(H3,19,20);2*1H |
| InChIKey | QKPKZTGTFUYFDJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 123.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|