C21H30N6 — CID 122182389
4-[7-(4-carbamimidoylanilino)heptylamino]benzenecarboximidamide (PubChem CID 122182389) has the molecular formula C21H30N6 and a molecular weight of 366.51 g/mol. Its IUPAC name is 4-[7-(4-carbamimidoylanilino)heptylamino]benzenecarboximidamide.
| Compound Name | 4-[7-(4-carbamimidoylanilino)heptylamino]benzenecarboximidamide |
|---|---|
| PubChem CID | 122182389 |
| Molecular Formula | C21H30N6 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 4-[7-(4-carbamimidoylanilino)heptylamino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NCCCCCCCNc2ccc(/C(N)=N/[H])cc2)cc1 |
| InChI | InChI=1S/C21H30N6/c22-20(23)16-6-10-18(11-7-16)26-14-4-2-1-3-5-15-27-19-12-8-17(9-13-19)21(24)25/h6-13,26-27H,1-5,14-15H2,(H3,22,23)(H3,24,25) |
| InChIKey | CPBAVONBUJGRKD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 123.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|