C10H15N3O — CID 82240553
4-(2-hydroxypropylamino)benzenecarboximidamide (PubChem CID 82240553) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-(2-hydroxypropylamino)benzenecarboximidamide.
| Compound Name | 4-(2-hydroxypropylamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 82240553 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 4-(2-hydroxypropylamino)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NCC(C)O)cc1 |
| InChI | InChI=1S/C10H15N3O/c1-7(14)6-13-9-4-2-8(3-5-9)10(11)12/h2-5,7,13-14H,6H2,1H3,(H3,11,12) |
| InChIKey | RJCMHLRXEKZBSL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 82.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|