C18H22N4O2 — CID 141009959
4-[[2-hydroxy-3-(phenacylamino)propyl]amino]benzenecarboximidamide (PubChem CID 141009959) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 4-[[2-hydroxy-3-(phenacylamino)propyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[2-hydroxy-3-(phenacylamino)propyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 141009959 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 4-[[2-hydroxy-3-(phenacylamino)propyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NCC(O)CNCC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H22N4O2/c19-18(20)14-6-8-15(9-7-14)22-11-16(23)10-21-12-17(24)13-4-2-1-3-5-13/h1-9,16,21-23H,10-12H2,(H3,19,20) |
| InChIKey | VIOLKCJKAWUKOB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 111.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|