C24H21N3O — CID 18404990
4-[3-(4-benzoyl-2-methylphenyl)prop-2-ynylamino]benzenecarboximidamide (PubChem CID 18404990) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-[3-(4-benzoyl-2-methylphenyl)prop-2-ynylamino]benzenecarboximidamide.
| Compound Name | 4-[3-(4-benzoyl-2-methylphenyl)prop-2-ynylamino]benzenecarboximidamide |
|---|---|
| PubChem CID | 18404990 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 4-[3-(4-benzoyl-2-methylphenyl)prop-2-ynylamino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NCC#Cc2ccc(C(=O)c3ccccc3)cc2C)cc1 |
| InChI | InChI=1S/C24H21N3O/c1-17-16-21(23(28)19-6-3-2-4-7-19)10-9-18(17)8-5-15-27-22-13-11-20(12-14-22)24(25)26/h2-4,6-7,9-14,16,27H,15H2,1H3,(H3,25,26) |
| InChIKey | NCYQKLUXUAAEPE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|