C26H32N4O3 — CID 18404838
methyl 3-[N-butanoyl-4-[3-(4-carbamimidoylanilino)prop-1-ynyl]-2,5-dimethylanilino]propanoate (PubChem CID 18404838) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is methyl 3-[N-butanoyl-4-[3-(4-carbamimidoylanilino)prop-1-ynyl]-2,5-dimethylanilino]propanoate.
| Compound Name | methyl 3-[N-butanoyl-4-[3-(4-carbamimidoylanilino)prop-1-ynyl]-2,5-dimethylanilino]propanoate |
|---|---|
| PubChem CID | 18404838 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | methyl 3-[N-butanoyl-4-[3-(4-carbamimidoylanilino)prop-1-ynyl]-2,5-dimethylanilino]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(NCC#Cc2cc(C)c(N(CCC(=O)OC)C(=O)CCC)cc2C)cc1 |
| InChI | InChI=1S/C26H32N4O3/c1-5-7-24(31)30(15-13-25(32)33-4)23-17-18(2)21(16-19(23)3)8-6-14-29-22-11-9-20(10-12-22)26(27)28/h9-12,16-17,29H,5,7,13-15H2,1-4H3,(H3,27,28) |
| InChIKey | ASUFXVNLIOKKLE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|