C28H34N4O3 — CID 18404956
ethyl 4-[4-[3-(4-carbamimidoylanilino)prop-1-ynyl]-N-cyclobutyl-2,5-dimethylanilino]-4-oxobutanoate (PubChem CID 18404956) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is ethyl 4-[4-[3-(4-carbamimidoylanilino)prop-1-ynyl]-N-cyclobutyl-2,5-dimethylanilino]-4-oxobutanoate.
| Compound Name | ethyl 4-[4-[3-(4-carbamimidoylanilino)prop-1-ynyl]-N-cyclobutyl-2,5-dimethylanilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 18404956 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | ethyl 4-[4-[3-(4-carbamimidoylanilino)prop-1-ynyl]-N-cyclobutyl-2,5-dimethylanilino]-4-oxobutanoate |
| SMILES | [H]/N=C(\N)c1ccc(NCC#Cc2cc(C)c(N(C(=O)CCC(=O)OCC)C3CCC3)cc2C)cc1 |
| InChI | InChI=1S/C28H34N4O3/c1-4-35-27(34)15-14-26(33)32(24-8-5-9-24)25-18-19(2)22(17-20(25)3)7-6-16-31-23-12-10-21(11-13-23)28(29)30/h10-13,17-18,24,31H,4-5,8-9,14-16H2,1-3H3,(H3,29,30) |
| InChIKey | GKXXCWJALJAJGM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|