C28H37N5O4 — CID 10279051
ethyl 3-[[4-[3-aminopropanoyl(cyclopentyl)amino]-3-methylbenzoyl]amino]-3-(3-carbamimidoylphenyl)propanoate (PubChem CID 10279051) has the molecular formula C28H37N5O4 and a molecular weight of 507.64 g/mol. Its IUPAC name is ethyl 3-[[4-[3-aminopropanoyl(cyclopentyl)amino]-3-methylbenzoyl]amino]-3-(3-carbamimidoylphenyl)propanoate.
| Compound Name | ethyl 3-[[4-[3-aminopropanoyl(cyclopentyl)amino]-3-methylbenzoyl]amino]-3-(3-carbamimidoylphenyl)propanoate |
|---|---|
| PubChem CID | 10279051 |
| Molecular Formula | C28H37N5O4 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | ethyl 3-[[4-[3-aminopropanoyl(cyclopentyl)amino]-3-methylbenzoyl]amino]-3-(3-carbamimidoylphenyl)propanoate |
| SMILES | [H]/N=C(\N)c1cccc(C(CC(=O)OCC)NC(=O)c2ccc(N(C(=O)CCN)C3CCCC3)c(C)c2)c1 |
| InChI | InChI=1S/C28H37N5O4/c1-3-37-26(35)17-23(19-7-6-8-20(16-19)27(30)31)32-28(36)21-11-12-24(18(2)15-21)33(25(34)13-14-29)22-9-4-5-10-22/h6-8,11-12,15-16,22-23H,3-5,9-10,13-14,17,29H2,1-2H3,(H3,30,31)(H,32,36) |
| InChIKey | AUAJUZWOFNOTQK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 151.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|