C25H27F6N5O8 — CID 160941767
ethyl (3R)-3-[(4-carbamimidoylbenzoyl)amino]-4-(3-carbamimidoylphenoxy)butanoate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 160941767) has the molecular formula C25H27F6N5O8 and a molecular weight of 639.51 g/mol. Its IUPAC name is ethyl (3R)-3-[(4-carbamimidoylbenzoyl)amino]-4-(3-carbamimidoylphenoxy)butanoate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | ethyl (3R)-3-[(4-carbamimidoylbenzoyl)amino]-4-(3-carbamimidoylphenoxy)butanoate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 160941767 |
| Molecular Formula | C25H27F6N5O8 |
| Molecular Weight | 639.51 g/mol |
| Exact Mass | 639.18 |
| IUPAC Name | ethyl (3R)-3-[(4-carbamimidoylbenzoyl)amino]-4-(3-carbamimidoylphenoxy)butanoate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(C(=O)N[C@@H](COc2cccc(/C(N)=N/[H])c2)CC(=O)OCC)cc1 |
| InChI | InChI=1S/C21H25N5O4.2C2HF3O2/c1-2-29-18(27)11-16(12-30-17-5-3-4-15(10-17)20(24)25)26-21(28)14-8-6-13(7-9-14)19(22)23;2*3-2(4,5)1(6)7/h3-10,16H,2,11-12H2,1H3,(H3,22,23)(H3,24,25)(H,26,28);2*(H,6,7)/t16-;;/m1../s1 |
| InChIKey | SUPHZLFSYXZHDS-GGMCWBHBSA-N |
| XLogP | 2.65 |
| TPSA | 238.97 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|