C28H30F6N6O11 — CID 87714240
(4R)-5-[5-carbamimidoyl-2-(2-carboxy-2-oxoethyl)phenoxy]-4-[[3-[(diaminomethylideneamino)methyl]benzoyl]amino]pentanoic acid;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87714240) has the molecular formula C28H30F6N6O11 and a molecular weight of 740.57 g/mol. Its IUPAC name is (4R)-5-[5-carbamimidoyl-2-(2-carboxy-2-oxoethyl)phenoxy]-4-[[3-[(diaminomethylideneamino)methyl]benzoyl]amino]pentanoic acid;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4R)-5-[5-carbamimidoyl-2-(2-carboxy-2-oxoethyl)phenoxy]-4-[[3-[(diaminomethylideneamino)methyl]benzoyl]amino]pentanoic acid;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87714240 |
| Molecular Formula | C28H30F6N6O11 |
| Molecular Weight | 740.57 g/mol |
| Exact Mass | 740.19 |
| IUPAC Name | (4R)-5-[5-carbamimidoyl-2-(2-carboxy-2-oxoethyl)phenoxy]-4-[[3-[(diaminomethylideneamino)methyl]benzoyl]amino]pentanoic acid;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(CC(=O)C(=O)O)c(OC[C@@H](CCC(=O)O)NC(=O)c2cccc(CN=C(N)N)c2)c1 |
| InChI | InChI=1S/C24H28N6O7.2C2HF3O2/c25-21(26)15-5-4-14(9-18(31)23(35)36)19(10-15)37-12-17(6-7-20(32)33)30-22(34)16-3-1-2-13(8-16)11-29-24(27)28;2*3-2(4,5)1(6)7/h1-5,8,10,17H,6-7,9,11-12H2,(H3,25,26)(H,30,34)(H,32,33)(H,35,36)(H4,27,28,29);2*(H,6,7)/t17-;;/m1../s1 |
| InChIKey | LNZFNZKOHMGTQI-ZEECNFPPSA-N |
| XLogP | 1.25 |
| TPSA | 318.87 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.57 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|