C25H23F6N5O6 — CID 10304224
1-[(3-carbamimidoylphenyl)methyl]-4-[(4-carbamimidoylphenyl)methyl]pyrrole-3-carboxylic acid;bis(2,2,2-trifluoroacetic acid) (PubChem CID 10304224) has the molecular formula C25H23F6N5O6 and a molecular weight of 603.48 g/mol. Its IUPAC name is 1-[(3-carbamimidoylphenyl)methyl]-4-[(4-carbamimidoylphenyl)methyl]pyrrole-3-carboxylic acid;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-[(3-carbamimidoylphenyl)methyl]-4-[(4-carbamimidoylphenyl)methyl]pyrrole-3-carboxylic acid;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 10304224 |
| Molecular Formula | C25H23F6N5O6 |
| Molecular Weight | 603.48 g/mol |
| Exact Mass | 603.16 |
| IUPAC Name | 1-[(3-carbamimidoylphenyl)methyl]-4-[(4-carbamimidoylphenyl)methyl]pyrrole-3-carboxylic acid;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(Cc2cn(Cc3cccc(/C(N)=N/[H])c3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C21H21N5O2.2C2HF3O2/c22-19(23)15-6-4-13(5-7-15)8-17-11-26(12-18(17)21(27)28)10-14-2-1-3-16(9-14)20(24)25;2*3-2(4,5)1(6)7/h1-7,9,11-12H,8,10H2,(H3,22,23)(H3,24,25)(H,27,28);2*(H,6,7) |
| InChIKey | HTJFGUXTPZCPAO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 216.57 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|