C22H24N6O3 — CID 54572868
1,3-bis[(3-carbamimidoylphenyl)methyl]-5-ethyl-2-oxoimidazole-4-carboxylic acid (PubChem CID 54572868) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is 1,3-bis[(3-carbamimidoylphenyl)methyl]-5-ethyl-2-oxoimidazole-4-carboxylic acid.
| Compound Name | 1,3-bis[(3-carbamimidoylphenyl)methyl]-5-ethyl-2-oxoimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 54572868 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 1,3-bis[(3-carbamimidoylphenyl)methyl]-5-ethyl-2-oxoimidazole-4-carboxylic acid |
| SMILES | [H]/N=C(\N)c1cccc(Cn2c(CC)c(C(=O)O)n(Cc3cccc(/C(N)=N/[H])c3)c2=O)c1 |
| InChI | InChI=1S/C22H24N6O3/c1-2-17-18(21(29)30)28(12-14-6-4-8-16(10-14)20(25)26)22(31)27(17)11-13-5-3-7-15(9-13)19(23)24/h3-10H,2,11-12H2,1H3,(H3,23,24)(H3,25,26)(H,29,30) |
| InChIKey | ZYNYUZDYMFPNKK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 163.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|