C10H12N4O — CID 87674720
3-(3-carbamimidoylphenyl)-2-iminopropanamide (PubChem CID 87674720) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 3-(3-carbamimidoylphenyl)-2-iminopropanamide.
| Compound Name | 3-(3-carbamimidoylphenyl)-2-iminopropanamide |
|---|---|
| PubChem CID | 87674720 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 3-(3-carbamimidoylphenyl)-2-iminopropanamide |
| SMILES | [H]/N=C(/Cc1cccc(/C(N)=N/[H])c1)C(N)=O |
| InChI | InChI=1S/C10H12N4O/c11-8(10(14)15)5-6-2-1-3-7(4-6)9(12)13/h1-4,11H,5H2,(H3,12,13)(H2,14,15)/b11-8- |
| InChIKey | NQDUXGOSSNUPGK-FLIBITNWSA-N |
| XLogP | 0.02 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|