About azanium 3-carbamimidoylbenzoate
azanium 3-carbamimidoylbenzoate (PubChem CID 69273733) has the molecular formula C8H11N3O2
and a molecular weight of 181.19 g/mol. Its IUPAC name is azanium 3-carbamimidoylbenzoate.
Molecular Properties
| Compound Name | azanium 3-carbamimidoylbenzoate |
| PubChem CID | 69273733 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | azanium 3-carbamimidoylbenzoate |
| SMILES | [H]/N=C(\N)c1cccc(C(=O)[O-])c1.[NH4+] |
| InChI | InChI=1S/C8H8N2O2.H3N/c9-7(10)5-2-1-3-6(4-5)8(11)12;/h1-4H,(H3,9,10)(H,11,12);1H3 |
| InChIKey | HHOSPLGPJMKRGF-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 126.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze azanium 3-carbamimidoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 3-carbamimidoylbenzoate?
The IUPAC name of azanium 3-carbamimidoylbenzoate (CID 69273733) is azanium 3-carbamimidoylbenzoate.
What is the SMILES notation for azanium 3-carbamimidoylbenzoate?
The canonical SMILES for azanium 3-carbamimidoylbenzoate is [H]/N=C(\N)c1cccc(C(=O)[O-])c1.[NH4+].
What is the InChIKey of azanium 3-carbamimidoylbenzoate?
The InChIKey is HHOSPLGPJMKRGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2.H3N/c9-7(10)5-2-1-3-6(4-5)8(11)12;/h1-4H,(H3,9,10)(H,11,12);1H3.
What are the key properties of azanium 3-carbamimidoylbenzoate?
azanium 3-carbamimidoylbenzoate has a molecular weight of 181.19 g/mol, XLogP of -0.29, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 3-carbamimidoylbenzoate is sourced from PubChem (CID 69273733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).