C25H23ClN6O — CID 10389462
N,1-bis[(3-carbamimidoylphenyl)methyl]-3-chloroindole-2-carboxamide (PubChem CID 10389462) has the molecular formula C25H23ClN6O and a molecular weight of 458.95 g/mol. Its IUPAC name is N,1-bis[(3-carbamimidoylphenyl)methyl]-3-chloroindole-2-carboxamide.
| Compound Name | N,1-bis[(3-carbamimidoylphenyl)methyl]-3-chloroindole-2-carboxamide |
|---|---|
| PubChem CID | 10389462 |
| Molecular Formula | C25H23ClN6O |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N,1-bis[(3-carbamimidoylphenyl)methyl]-3-chloroindole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(CNC(=O)c2c(Cl)c3ccccc3n2Cc2cccc(/C(N)=N/[H])c2)c1 |
| InChI | InChI=1S/C25H23ClN6O/c26-21-19-9-1-2-10-20(19)32(14-16-6-4-8-18(12-16)24(29)30)22(21)25(33)31-13-15-5-3-7-17(11-15)23(27)28/h1-12H,13-14H2,(H3,27,28)(H3,29,30)(H,31,33) |
| InChIKey | ZBKZQMSDWQOTEJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 133.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|