C34H26N4O2 — CID 10918387
1-[(3-carbamimidoylphenyl)methyl]-4-hydroxy-N-(pyren-1-ylmethyl)indole-2-carboxamide (PubChem CID 10918387) has the molecular formula C34H26N4O2 and a molecular weight of 522.61 g/mol. Its IUPAC name is 1-[(3-carbamimidoylphenyl)methyl]-4-hydroxy-N-(pyren-1-ylmethyl)indole-2-carboxamide.
| Compound Name | 1-[(3-carbamimidoylphenyl)methyl]-4-hydroxy-N-(pyren-1-ylmethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 10918387 |
| Molecular Formula | C34H26N4O2 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 1-[(3-carbamimidoylphenyl)methyl]-4-hydroxy-N-(pyren-1-ylmethyl)indole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(Cn2c(C(=O)NCc3ccc4ccc5cccc6ccc3c4c56)cc3c(O)cccc32)c1 |
| InChI | InChI=1S/C34H26N4O2/c35-33(36)24-7-1-4-20(16-24)19-38-28-8-3-9-30(39)27(28)17-29(38)34(40)37-18-25-13-12-23-11-10-21-5-2-6-22-14-15-26(25)32(23)31(21)22/h1-17,39H,18-19H2,(H3,35,36)(H,37,40) |
| InChIKey | UANADXVNPMYRQU-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 104.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|