C26H23N5O — CID 10949866
N-[(3-carbamimidoylphenyl)methyl]-1-[(3-cyanophenyl)methyl]-4-methylindole-2-carboxamide (PubChem CID 10949866) has the molecular formula C26H23N5O and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[(3-carbamimidoylphenyl)methyl]-1-[(3-cyanophenyl)methyl]-4-methylindole-2-carboxamide.
| Compound Name | N-[(3-carbamimidoylphenyl)methyl]-1-[(3-cyanophenyl)methyl]-4-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 10949866 |
| Molecular Formula | C26H23N5O |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | N-[(3-carbamimidoylphenyl)methyl]-1-[(3-cyanophenyl)methyl]-4-methylindole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(CNC(=O)c2cc3c(C)cccc3n2Cc2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C26H23N5O/c1-17-5-2-10-23-22(17)13-24(31(23)16-20-8-3-6-18(11-20)14-27)26(32)30-15-19-7-4-9-21(12-19)25(28)29/h2-13H,15-16H2,1H3,(H3,28,29)(H,30,32) |
| InChIKey | JUVZDJRQUHTLFA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|