C27H29N6O3+ — CID 11814015
[4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-nitroindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium (PubChem CID 11814015) has the molecular formula C27H29N6O3+ and a molecular weight of 485.57 g/mol. Its IUPAC name is [4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-nitroindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium.
| Compound Name | [4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-nitroindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium |
|---|---|
| PubChem CID | 11814015 |
| Molecular Formula | C27H29N6O3+ |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | [4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-nitroindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium |
| SMILES | [H]/N=C(\N)c1cccc(Cn2c(C(=O)NCc3ccc([N+](C)(C)C)cc3)cc3cc([N+](=O)[O-])ccc32)c1 |
| InChI | InChI=1S/C27H28N6O3/c1-33(2,3)23-10-7-18(8-11-23)16-30-27(34)25-15-21-14-22(32(35)36)9-12-24(21)31(25)17-19-5-4-6-20(13-19)26(28)29/h4-15H,16-17H2,1-3H3,(H3-,28,29,30,34)/p+1 |
| InChIKey | UNBRJUFLVAWRRR-UHFFFAOYSA-O |
| XLogP | 4.01 |
| TPSA | 127.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|