C31H35ClFN5O3 — CID 18327562
acetic acid;[4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-fluoroindole-2-carbonyl]amino]methyl]phenyl]-dimethyl-prop-2-enylazanium;chloride (PubChem CID 18327562) has the molecular formula C31H35ClFN5O3 and a molecular weight of 580.10 g/mol. Its IUPAC name is acetic acid;[4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-fluoroindole-2-carbonyl]amino]methyl]phenyl]-dimethyl-prop-2-enylazanium;chloride.
| Compound Name | acetic acid;[4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-fluoroindole-2-carbonyl]amino]methyl]phenyl]-dimethyl-prop-2-enylazanium;chloride |
|---|---|
| PubChem CID | 18327562 |
| Molecular Formula | C31H35ClFN5O3 |
| Molecular Weight | 580.10 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | acetic acid;[4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-fluoroindole-2-carbonyl]amino]methyl]phenyl]-dimethyl-prop-2-enylazanium;chloride |
| SMILES | CC(=O)O.[Cl-].[H]/N=C(\N)c1cccc(Cn2c(C(=O)NCc3ccc([N+](C)(C)CC=C)cc3)cc3cc(F)ccc32)c1 |
| InChI | InChI=1S/C29H30FN5O.C2H4O2.ClH/c1-4-14-35(2,3)25-11-8-20(9-12-25)18-33-29(36)27-17-23-16-24(30)10-13-26(23)34(27)19-21-6-5-7-22(15-21)28(31)32;1-2(3)4;/h4-13,15-17H,1,14,18-19H2,2-3H3,(H3-,31,32,33,36);1H3,(H,3,4);1H |
| InChIKey | PNGLSNRYCJDXCM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 121.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.10 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|