C28H28FIN4O — CID 18327657
[4-[[[1-[(3-cyanophenyl)methyl]-5-fluoroindole-2-carbonyl]amino]methyl]phenyl]-ethyl-dimethylazanium iodide (PubChem CID 18327657) has the molecular formula C28H28FIN4O and a molecular weight of 582.46 g/mol. Its IUPAC name is [4-[[[1-[(3-cyanophenyl)methyl]-5-fluoroindole-2-carbonyl]amino]methyl]phenyl]-ethyl-dimethylazanium iodide.
| Compound Name | [4-[[[1-[(3-cyanophenyl)methyl]-5-fluoroindole-2-carbonyl]amino]methyl]phenyl]-ethyl-dimethylazanium iodide |
|---|---|
| PubChem CID | 18327657 |
| Molecular Formula | C28H28FIN4O |
| Molecular Weight | 582.46 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | [4-[[[1-[(3-cyanophenyl)methyl]-5-fluoroindole-2-carbonyl]amino]methyl]phenyl]-ethyl-dimethylazanium iodide |
| SMILES | CC[N+](C)(C)c1ccc(CNC(=O)c2cc3cc(F)ccc3n2Cc2cccc(C#N)c2)cc1.[I-] |
| InChI | InChI=1S/C28H27FN4O.HI/c1-4-33(2,3)25-11-8-20(9-12-25)18-31-28(34)27-16-23-15-24(29)10-13-26(23)32(27)19-22-7-5-6-21(14-22)17-30;/h5-16H,4,18-19H2,1-3H3;1H |
| InChIKey | NKOUZEZKNWSJOW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|