C29H26ClF3N4O3 — CID 11734499
[4-[[[5-chloro-1-[(3-cyanophenyl)methyl]indole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate (PubChem CID 11734499) has the molecular formula C29H26ClF3N4O3 and a molecular weight of 571.00 g/mol. Its IUPAC name is [4-[[[5-chloro-1-[(3-cyanophenyl)methyl]indole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate.
| Compound Name | [4-[[[5-chloro-1-[(3-cyanophenyl)methyl]indole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11734499 |
| Molecular Formula | C29H26ClF3N4O3 |
| Molecular Weight | 571.00 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | [4-[[[5-chloro-1-[(3-cyanophenyl)methyl]indole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate |
| SMILES | C[N+](C)(C)c1ccc(CNC(=O)c2cc3cc(Cl)ccc3n2Cc2cccc(C#N)c2)cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C27H25ClN4O.C2HF3O2/c1-32(2,3)24-10-7-19(8-11-24)17-30-27(33)26-15-22-14-23(28)9-12-25(22)31(26)18-21-6-4-5-20(13-21)16-29;3-2(4,5)1(6)7/h4-15H,17-18H2,1-3H3;(H,6,7) |
| InChIKey | URLARWZBJSHZLI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.00 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|