C28H29N4O+ — CID 11038924
[4-[[[1-[(3-cyanophenyl)methyl]-4-methylindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium (PubChem CID 11038924) has the molecular formula C28H29N4O+ and a molecular weight of 437.57 g/mol. Its IUPAC name is [4-[[[1-[(3-cyanophenyl)methyl]-4-methylindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium.
| Compound Name | [4-[[[1-[(3-cyanophenyl)methyl]-4-methylindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium |
|---|---|
| PubChem CID | 11038924 |
| Molecular Formula | C28H29N4O+ |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | [4-[[[1-[(3-cyanophenyl)methyl]-4-methylindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium |
| SMILES | Cc1cccc2c1cc(C(=O)NCc1ccc([N+](C)(C)C)cc1)n2Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C28H28N4O/c1-20-7-5-10-26-25(20)16-27(31(26)19-23-9-6-8-22(15-23)17-29)28(33)30-18-21-11-13-24(14-12-21)32(2,3)4/h5-16H,18-19H2,1-4H3/p+1 |
| InChIKey | ZLIDXCRMSODHPC-UHFFFAOYSA-O |
| XLogP | 5.00 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|