C28H21N3O2 — CID 10950077
1-[(3-cyanophenyl)methyl]-4-hydroxy-N-(naphthalen-1-ylmethyl)indole-2-carboxamide (PubChem CID 10950077) has the molecular formula C28H21N3O2 and a molecular weight of 431.50 g/mol. Its IUPAC name is 1-[(3-cyanophenyl)methyl]-4-hydroxy-N-(naphthalen-1-ylmethyl)indole-2-carboxamide.
| Compound Name | 1-[(3-cyanophenyl)methyl]-4-hydroxy-N-(naphthalen-1-ylmethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 10950077 |
| Molecular Formula | C28H21N3O2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1-[(3-cyanophenyl)methyl]-4-hydroxy-N-(naphthalen-1-ylmethyl)indole-2-carboxamide |
| SMILES | N#Cc1cccc(Cn2c(C(=O)NCc3cccc4ccccc34)cc3c(O)cccc32)c1 |
| InChI | InChI=1S/C28H21N3O2/c29-16-19-6-3-7-20(14-19)18-31-25-12-5-13-27(32)24(25)15-26(31)28(33)30-17-22-10-4-9-21-8-1-2-11-23(21)22/h1-15,32H,17-18H2,(H,30,33) |
| InChIKey | IFAAEEJNEHTQLW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |