C34H37I2N5O2 — CID 18327665
[4-[[[1-[(3-carbamimidoylphenyl)methyl]-4-phenylmethoxyindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;iodide;hydroiodide (PubChem CID 18327665) has the molecular formula C34H37I2N5O2 and a molecular weight of 801.51 g/mol. Its IUPAC name is [4-[[[1-[(3-carbamimidoylphenyl)methyl]-4-phenylmethoxyindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;iodide;hydroiodide.
| Compound Name | [4-[[[1-[(3-carbamimidoylphenyl)methyl]-4-phenylmethoxyindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;iodide;hydroiodide |
|---|---|
| PubChem CID | 18327665 |
| Molecular Formula | C34H37I2N5O2 |
| Molecular Weight | 801.51 g/mol |
| Exact Mass | 801.10 |
| IUPAC Name | [4-[[[1-[(3-carbamimidoylphenyl)methyl]-4-phenylmethoxyindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;iodide;hydroiodide |
| SMILES | I.[H]/N=C(\N)c1cccc(Cn2c(C(=O)NCc3ccc([N+](C)(C)C)cc3)cc3c(OCc4ccccc4)cccc32)c1.[I-] |
| InChI | InChI=1S/C34H35N5O2.2HI/c1-39(2,3)28-17-15-24(16-18-28)21-37-34(40)31-20-29-30(38(31)22-26-11-7-12-27(19-26)33(35)36)13-8-14-32(29)41-23-25-9-5-4-6-10-25;;/h4-20H,21-23H2,1-3H3,(H3-,35,36,37,40);2*1H |
| InChIKey | BFTHYINBOQZNFU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|