C31H31F6N5O6 — CID 86757724
[4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-hydroxyindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid (PubChem CID 86757724) has the molecular formula C31H31F6N5O6 and a molecular weight of 683.61 g/mol. Its IUPAC name is [4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-hydroxyindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid.
| Compound Name | [4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-hydroxyindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86757724 |
| Molecular Formula | C31H31F6N5O6 |
| Molecular Weight | 683.61 g/mol |
| Exact Mass | 683.22 |
| IUPAC Name | [4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-hydroxyindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C([O-])C(F)(F)F.[H]/N=C(\N)c1cccc(Cn2c(C(=O)NCc3ccc([N+](C)(C)C)cc3)cc3cc(O)ccc32)c1 |
| InChI | InChI=1S/C27H29N5O2.2C2HF3O2/c1-32(2,3)22-9-7-18(8-10-22)16-30-27(34)25-15-21-14-23(33)11-12-24(21)31(25)17-19-5-4-6-20(13-19)26(28)29;2*3-2(4,5)1(6)7/h4-15H,16-17H2,1-3H3,(H4-,28,29,30,33,34);2*(H,6,7) |
| InChIKey | HHGOIRDVUUXPMK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 181.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.61 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|