C32H32F6N5O5+ — CID 87992119
[4-[[[1-[(3-carbamimidoylphenyl)methyl]-4-methoxyindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate (PubChem CID 87992119) has the molecular formula C32H32F6N5O5+ and a molecular weight of 680.63 g/mol. Its IUPAC name is [4-[[[1-[(3-carbamimidoylphenyl)methyl]-4-methoxyindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate.
| Compound Name | [4-[[[1-[(3-carbamimidoylphenyl)methyl]-4-methoxyindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87992119 |
| Molecular Formula | C32H32F6N5O5+ |
| Molecular Weight | 680.63 g/mol |
| Exact Mass | 680.23 |
| IUPAC Name | [4-[[[1-[(3-carbamimidoylphenyl)methyl]-4-methoxyindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
| SMILES | O=C(OC(=O)C(F)(F)F)C(F)(F)F.[H]/N=C(\N)c1cccc(Cn2c(C(=O)NCc3ccc([N+](C)(C)C)cc3)cc3c(OC)cccc32)c1 |
| InChI | InChI=1S/C28H31N5O2.C4F6O3/c1-33(2,3)22-13-11-19(12-14-22)17-31-28(34)25-16-23-24(9-6-10-26(23)35-4)32(25)18-20-7-5-8-21(15-20)27(29)30;5-3(6,7)1(11)13-2(12)4(8,9)10/h5-16H,17-18H2,1-4H3,(H3-,29,30,31,34);/p+1 |
| InChIKey | UJNUQGZJWYXILQ-UHFFFAOYSA-O |
| XLogP | 5.29 |
| TPSA | 136.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.63 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|