C26H26N4O3 — CID 11091496
1-[(3-carbamimidoylphenyl)methyl]-N-[2-(4-hydroxyphenyl)ethyl]-4-methoxyindole-2-carboxamide (PubChem CID 11091496) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is 1-[(3-carbamimidoylphenyl)methyl]-N-[2-(4-hydroxyphenyl)ethyl]-4-methoxyindole-2-carboxamide.
| Compound Name | 1-[(3-carbamimidoylphenyl)methyl]-N-[2-(4-hydroxyphenyl)ethyl]-4-methoxyindole-2-carboxamide |
|---|---|
| PubChem CID | 11091496 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 1-[(3-carbamimidoylphenyl)methyl]-N-[2-(4-hydroxyphenyl)ethyl]-4-methoxyindole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(Cn2c(C(=O)NCCc3ccc(O)cc3)cc3c(OC)cccc32)c1 |
| InChI | InChI=1S/C26H26N4O3/c1-33-24-7-3-6-22-21(24)15-23(26(32)29-13-12-17-8-10-20(31)11-9-17)30(22)16-18-4-2-5-19(14-18)25(27)28/h2-11,14-15,31H,12-13,16H2,1H3,(H3,27,28)(H,29,32) |
| InChIKey | XDQPYGTXENDOLI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 113.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|