C28H25F3N4O4 — CID 11103488
1-[(3-cyanophenyl)methyl]-4-methoxy-N-[2-(1-methylpyridin-1-ium-4-yl)ethyl]indole-2-carboxamide;2,2,2-trifluoroacetate (PubChem CID 11103488) has the molecular formula C28H25F3N4O4 and a molecular weight of 538.53 g/mol. Its IUPAC name is 1-[(3-cyanophenyl)methyl]-4-methoxy-N-[2-(1-methylpyridin-1-ium-4-yl)ethyl]indole-2-carboxamide;2,2,2-trifluoroacetate.
| Compound Name | 1-[(3-cyanophenyl)methyl]-4-methoxy-N-[2-(1-methylpyridin-1-ium-4-yl)ethyl]indole-2-carboxamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11103488 |
| Molecular Formula | C28H25F3N4O4 |
| Molecular Weight | 538.53 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 1-[(3-cyanophenyl)methyl]-4-methoxy-N-[2-(1-methylpyridin-1-ium-4-yl)ethyl]indole-2-carboxamide;2,2,2-trifluoroacetate |
| SMILES | COc1cccc2c1cc(C(=O)NCCc1cc[n+](C)cc1)n2Cc1cccc(C#N)c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C26H24N4O2.C2HF3O2/c1-29-13-10-19(11-14-29)9-12-28-26(31)24-16-22-23(7-4-8-25(22)32-2)30(24)18-21-6-3-5-20(15-21)17-27;3-2(4,5)1(6)7/h3-8,10-11,13-16H,9,12,18H2,1-2H3;(H,6,7) |
| InChIKey | YNHYUSZJSWNLJR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 111.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|