C31H33FN2O4 — CID 42804823
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(2-fluorophenyl)methoxy]-1-(3-methylbut-2-enyl)indole-2-carboxamide (PubChem CID 42804823) has the molecular formula C31H33FN2O4 and a molecular weight of 516.61 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(2-fluorophenyl)methoxy]-1-(3-methylbut-2-enyl)indole-2-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(2-fluorophenyl)methoxy]-1-(3-methylbut-2-enyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 42804823 |
| Molecular Formula | C31H33FN2O4 |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(2-fluorophenyl)methoxy]-1-(3-methylbut-2-enyl)indole-2-carboxamide |
| SMILES | COc1ccc(CCNC(=O)c2cc3c(OCc4ccccc4F)cccc3n2CC=C(C)C)cc1OC |
| InChI | InChI=1S/C31H33FN2O4/c1-21(2)15-17-34-26-10-7-11-28(38-20-23-8-5-6-9-25(23)32)24(26)19-27(34)31(35)33-16-14-22-12-13-29(36-3)30(18-22)37-4/h5-13,15,18-19H,14,16-17,20H2,1-4H3,(H,33,35) |
| InChIKey | DJWBZEIRXDDZBY-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|