C30H32FN3O5 — CID 22429620
N-[2-(3,4-dimethoxyphenyl)ethyl]-5-[1-[(2-fluorophenyl)methyl]-2,4-dioxoquinazolin-3-yl]pentanamide (PubChem CID 22429620) has the molecular formula C30H32FN3O5 and a molecular weight of 533.60 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-5-[1-[(2-fluorophenyl)methyl]-2,4-dioxoquinazolin-3-yl]pentanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-5-[1-[(2-fluorophenyl)methyl]-2,4-dioxoquinazolin-3-yl]pentanamide |
|---|---|
| PubChem CID | 22429620 |
| Molecular Formula | C30H32FN3O5 |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-5-[1-[(2-fluorophenyl)methyl]-2,4-dioxoquinazolin-3-yl]pentanamide |
| SMILES | COc1ccc(CCNC(=O)CCCCn2c(=O)c3ccccc3n(Cc3ccccc3F)c2=O)cc1OC |
| InChI | InChI=1S/C30H32FN3O5/c1-38-26-15-14-21(19-27(26)39-2)16-17-32-28(35)13-7-8-18-33-29(36)23-10-4-6-12-25(23)34(30(33)37)20-22-9-3-5-11-24(22)31/h3-6,9-12,14-15,19H,7-8,13,16-18,20H2,1-2H3,(H,32,35) |
| InChIKey | GUYDLJKQDGUBRH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|