C20H25FN2O3 — CID 109020704
3-[2-(3,4-dimethoxyphenyl)ethylamino]-N-[(2-fluorophenyl)methyl]propanamide (PubChem CID 109020704) has the molecular formula C20H25FN2O3 and a molecular weight of 360.43 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethylamino]-N-[(2-fluorophenyl)methyl]propanamide.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethylamino]-N-[(2-fluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 109020704 |
| Molecular Formula | C20H25FN2O3 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethylamino]-N-[(2-fluorophenyl)methyl]propanamide |
| SMILES | COc1ccc(CCNCCC(=O)NCc2ccccc2F)cc1OC |
| InChI | InChI=1S/C20H25FN2O3/c1-25-18-8-7-15(13-19(18)26-2)9-11-22-12-10-20(24)23-14-16-5-3-4-6-17(16)21/h3-8,13,22H,9-12,14H2,1-2H3,(H,23,24) |
| InChIKey | FPPVCFUCORCPHH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|