C21H20FNO3 — CID 42666942
4-[(2-fluorophenyl)methoxy]-1-(3-methylbut-2-enyl)indole-2-carboxylic acid (PubChem CID 42666942) has the molecular formula C21H20FNO3 and a molecular weight of 353.39 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)methoxy]-1-(3-methylbut-2-enyl)indole-2-carboxylic acid.
| Compound Name | 4-[(2-fluorophenyl)methoxy]-1-(3-methylbut-2-enyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 42666942 |
| Molecular Formula | C21H20FNO3 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 4-[(2-fluorophenyl)methoxy]-1-(3-methylbut-2-enyl)indole-2-carboxylic acid |
| SMILES | CC(C)=CCn1c(C(=O)O)cc2c(OCc3ccccc3F)cccc21 |
| InChI | InChI=1S/C21H20FNO3/c1-14(2)10-11-23-18-8-5-9-20(16(18)12-19(23)21(24)25)26-13-15-6-3-4-7-17(15)22/h3-10,12H,11,13H2,1-2H3,(H,24,25) |
| InChIKey | BATKVSIGMJJRPP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|