C18H16FNO3 — CID 42803250
4-ethoxy-1-[(3-fluorophenyl)methyl]indole-2-carboxylic acid (PubChem CID 42803250) has the molecular formula C18H16FNO3 and a molecular weight of 313.33 g/mol. Its IUPAC name is 4-ethoxy-1-[(3-fluorophenyl)methyl]indole-2-carboxylic acid.
| Compound Name | 4-ethoxy-1-[(3-fluorophenyl)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 42803250 |
| Molecular Formula | C18H16FNO3 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 4-ethoxy-1-[(3-fluorophenyl)methyl]indole-2-carboxylic acid |
| SMILES | CCOc1cccc2c1cc(C(=O)O)n2Cc1cccc(F)c1 |
| InChI | InChI=1S/C18H16FNO3/c1-2-23-17-8-4-7-15-14(17)10-16(18(21)22)20(15)11-12-5-3-6-13(19)9-12/h3-10H,2,11H2,1H3,(H,21,22) |
| InChIKey | XSRPZGIRDXCKQE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |