C26H27FN2O4 — CID 42667050
1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[1-[(3-fluorophenyl)methyl]-4-prop-2-enoxyindol-2-yl]methanone (PubChem CID 42667050) has the molecular formula C26H27FN2O4 and a molecular weight of 450.51 g/mol. Its IUPAC name is 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[1-[(3-fluorophenyl)methyl]-4-prop-2-enoxyindol-2-yl]methanone.
| Compound Name | 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[1-[(3-fluorophenyl)methyl]-4-prop-2-enoxyindol-2-yl]methanone |
|---|---|
| PubChem CID | 42667050 |
| Molecular Formula | C26H27FN2O4 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[1-[(3-fluorophenyl)methyl]-4-prop-2-enoxyindol-2-yl]methanone |
| SMILES | C=CCOc1cccc2c1cc(C(=O)N1CCC3(CC1)OCCO3)n2Cc1cccc(F)c1 |
| InChI | InChI=1S/C26H27FN2O4/c1-2-13-31-24-8-4-7-22-21(24)17-23(29(22)18-19-5-3-6-20(27)16-19)25(30)28-11-9-26(10-12-28)32-14-15-33-26/h2-8,16-17H,1,9-15,18H2 |
| InChIKey | PXMLNOSUWGBALC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 52.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|