C28H31N3O4 — CID 42667161
[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[1-[(Z)-but-2-enyl]-4-prop-2-enoxyindol-2-yl]methanone (PubChem CID 42667161) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[1-[(Z)-but-2-enyl]-4-prop-2-enoxyindol-2-yl]methanone.
| Compound Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[1-[(Z)-but-2-enyl]-4-prop-2-enoxyindol-2-yl]methanone |
|---|---|
| PubChem CID | 42667161 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[1-[(Z)-but-2-enyl]-4-prop-2-enoxyindol-2-yl]methanone |
| SMILES | C=CCOc1cccc2c1cc(C(=O)N1CCN(Cc3ccc4c(c3)OCO4)CC1)n2C/C=C\C |
| InChI | InChI=1S/C28H31N3O4/c1-3-5-11-31-23-7-6-8-25(33-16-4-2)22(23)18-24(31)28(32)30-14-12-29(13-15-30)19-21-9-10-26-27(17-21)35-20-34-26/h3-10,17-18H,2,11-16,19-20H2,1H3/b5-3- |
| InChIKey | AMLHAUMJVTXCAC-HYXAFXHYSA-N |
| XLogP | 4.47 |
| TPSA | 56.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|