C25H28N2O2 — CID 42667129
[1-[(4-methylphenyl)methyl]-4-prop-2-enoxyindol-2-yl]-piperidin-1-ylmethanone (PubChem CID 42667129) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is [1-[(4-methylphenyl)methyl]-4-prop-2-enoxyindol-2-yl]-piperidin-1-ylmethanone.
| Compound Name | [1-[(4-methylphenyl)methyl]-4-prop-2-enoxyindol-2-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 42667129 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | [1-[(4-methylphenyl)methyl]-4-prop-2-enoxyindol-2-yl]-piperidin-1-ylmethanone |
| SMILES | C=CCOc1cccc2c1cc(C(=O)N1CCCCC1)n2Cc1ccc(C)cc1 |
| InChI | InChI=1S/C25H28N2O2/c1-3-16-29-24-9-7-8-22-21(24)17-23(25(28)26-14-5-4-6-15-26)27(22)18-20-12-10-19(2)11-13-20/h3,7-13,17H,1,4-6,14-16,18H2,2H3 |
| InChIKey | NZLJFXPLVNDCSH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|